C18H24OSi — CID 173126336
1,1-diphenylbutoxy(ethyl)silane (PubChem CID 173126336) has the molecular formula C18H24OSi and a molecular weight of 284.48 g/mol. Its IUPAC name is 1,1-diphenylbutoxy(ethyl)silane.
| Compound Name | 1,1-diphenylbutoxy(ethyl)silane |
|---|---|
| PubChem CID | 173126336 |
| Molecular Formula | C18H24OSi |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1,1-diphenylbutoxy(ethyl)silane |
| SMILES | CCCC(O[SiH2]CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24OSi/c1-3-15-18(19-20-4-2,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14H,3-4,15,20H2,1-2H3 |
| InChIKey | UFKLQJNBRXKLEY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|