About alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane
alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane (PubChem CID 173133671) has the molecular formula H7AlO8Si3
and a molecular weight of 246.29 g/mol. Its IUPAC name is alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane.
Molecular Properties
| Compound Name | alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane |
| PubChem CID | 173133671 |
| Molecular Formula | H7AlO8Si3 |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane |
| SMILES | O=[Si](O)O.O=[Si](O)O[Si](=O)O.[AlH3] |
| InChI | InChI=1S/Al.H2O5Si2.H2O3Si.3H/c;1-6(2)5-7(3)4;1-4(2)3;;;/h;1,3H;1-2H;;; |
| InChIKey | YTQXJUFAOTZEAL-UHFFFAOYSA-N |
| XLogP | -4.98 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane?
The IUPAC name of alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane (CID 173133671) is alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane.
What is the SMILES notation for alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane?
The canonical SMILES for alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane is O=[Si](O)O.O=[Si](O)O[Si](=O)O.[AlH3].
What is the InChIKey of alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane?
The InChIKey is YTQXJUFAOTZEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/Al.H2O5Si2.H2O3Si.3H/c;1-6(2)5-7(3)4;1-4(2)3;;;/h;1,3H;1-2H;;;.
What are the key properties of alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane?
alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane has a molecular weight of 246.29 g/mol, XLogP of -4.98, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;dihydroxy(oxo)silane;hydroxy-[hydroxy(oxo)silyl]oxy-oxosilane is sourced from PubChem (CID 173133671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).