C51H64Zr — CID 173135093
cyclopenta-1,3-diene;2,7-dimethyl-3,6-bis(1-phenylpentan-2-yl)-1,9-dihydrofluoren-1-ide;nonan-5-ylidenezirconium(2+) (PubChem CID 173135093) has the molecular formula C51H64Zr and a molecular weight of 768.30 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2,7-dimethyl-3,6-bis(1-phenylpentan-2-yl)-1,9-dihydrofluoren-1-ide;nonan-5-ylidenezirconium(2+).
| Compound Name | cyclopenta-1,3-diene;2,7-dimethyl-3,6-bis(1-phenylpentan-2-yl)-1,9-dihydrofluoren-1-ide;nonan-5-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 173135093 |
| Molecular Formula | C51H64Zr |
| Molecular Weight | 768.30 g/mol |
| Exact Mass | 766.41 |
| IUPAC Name | cyclopenta-1,3-diene;2,7-dimethyl-3,6-bis(1-phenylpentan-2-yl)-1,9-dihydrofluoren-1-ide;nonan-5-ylidenezirconium(2+) |
| SMILES | CCCC(Cc1ccccc1)c1cc2c([c-]c1C)Cc1cc(C)c(C(CCC)Cc3ccccc3)cc1-2.CCCCC(=[Zr+2])CCCC.[C-]1=CC=CC1 |
| InChI | InChI=1S/C37H41.C9H18.C5H5.Zr/c1-5-13-30(21-28-15-9-7-10-16-28)34-24-36-32(19-26(34)3)23-33-20-27(4)35(25-37(33)36)31(14-6-2)22-29-17-11-8-12-18-29;1-3-5-7-9-8-6-4-2;1-2-4-5-3-1;/h7-12,15-19,24-25,30-31H,5-6,13-14,21-23H2,1-4H3;3-8H2,1-2H3;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | LZOHAOYXKYFZGN-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.30 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|