C19H19FIN3O4S — CID 173135254
3-[3-[4-(2-fluorophenyl)-2-iodopiperazin-1-yl]sulfonylphenyl]-N-hydroxyprop-2-enamide (PubChem CID 173135254) has the molecular formula C19H19FIN3O4S and a molecular weight of 531.35 g/mol. Its IUPAC name is 3-[3-[4-(2-fluorophenyl)-2-iodopiperazin-1-yl]sulfonylphenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[3-[4-(2-fluorophenyl)-2-iodopiperazin-1-yl]sulfonylphenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 173135254 |
| Molecular Formula | C19H19FIN3O4S |
| Molecular Weight | 531.35 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | 3-[3-[4-(2-fluorophenyl)-2-iodopiperazin-1-yl]sulfonylphenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1cccc(S(=O)(=O)N2CCN(c3ccccc3F)CC2I)c1)NO |
| InChI | InChI=1S/C19H19FIN3O4S/c20-16-6-1-2-7-17(16)23-10-11-24(18(21)13-23)29(27,28)15-5-3-4-14(12-15)8-9-19(25)22-26/h1-9,12,18,26H,10-11,13H2,(H,22,25) |
| InChIKey | VELHCRUCFHWTAG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|