C16H15ClKN3O — CID 173137136
potassium;(E)-3-[5-(5-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enal;hydride (PubChem CID 173137136) has the molecular formula C16H15ClKN3O and a molecular weight of 339.87 g/mol. Its IUPAC name is potassium;(E)-3-[5-(5-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enal;hydride.
| Compound Name | potassium;(E)-3-[5-(5-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enal;hydride |
|---|---|
| PubChem CID | 173137136 |
| Molecular Formula | C16H15ClKN3O |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | potassium;(E)-3-[5-(5-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enal;hydride |
| SMILES | Cc1nn(C)c(-n2ccc3cc(Cl)ccc32)c1/C=C/C=O.[H-].[K+] |
| InChI | InChI=1S/C16H14ClN3O.K.H/c1-11-14(4-3-9-21)16(19(2)18-11)20-8-7-12-10-13(17)5-6-15(12)20;;/h3-10H,1-2H3;;/q;+1;-1/b4-3+;; |
| InChIKey | UGKMWQJWRTUWCG-CZEFNJPISA-N |
| XLogP | 0.65 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|