C20H21NO4S — CID 173139151
[5-[(4-methoxyphenyl)methylamino]cyclohexa-1,5-dien-1-yl] benzenesulfonate (PubChem CID 173139151) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is [5-[(4-methoxyphenyl)methylamino]cyclohexa-1,5-dien-1-yl] benzenesulfonate.
| Compound Name | [5-[(4-methoxyphenyl)methylamino]cyclohexa-1,5-dien-1-yl] benzenesulfonate |
|---|---|
| PubChem CID | 173139151 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [5-[(4-methoxyphenyl)methylamino]cyclohexa-1,5-dien-1-yl] benzenesulfonate |
| SMILES | COc1ccc(CNC2=CC(OS(=O)(=O)c3ccccc3)=CCC2)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-24-18-12-10-16(11-13-18)15-21-17-6-5-7-19(14-17)25-26(22,23)20-8-3-2-4-9-20/h2-4,7-14,21H,5-6,15H2,1H3 |
| InChIKey | KFVPAQKEGFQZKW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|