C12H12NNaO8S2 — CID 173140998
sodium;4-(2-amino-1-hydroxy-2-oxoethyl)naphthalene-2,7-disulfonic acid;hydride (PubChem CID 173140998) has the molecular formula C12H12NNaO8S2 and a molecular weight of 385.35 g/mol. Its IUPAC name is sodium;4-(2-amino-1-hydroxy-2-oxoethyl)naphthalene-2,7-disulfonic acid;hydride.
| Compound Name | sodium;4-(2-amino-1-hydroxy-2-oxoethyl)naphthalene-2,7-disulfonic acid;hydride |
|---|---|
| PubChem CID | 173140998 |
| Molecular Formula | C12H12NNaO8S2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | sodium;4-(2-amino-1-hydroxy-2-oxoethyl)naphthalene-2,7-disulfonic acid;hydride |
| SMILES | NC(=O)C(O)c1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)ccc12.[H-].[Na+] |
| InChI | InChI=1S/C12H11NO8S2.Na.H/c13-12(15)11(14)10-5-8(23(19,20)21)4-6-3-7(22(16,17)18)1-2-9(6)10;;/h1-5,11,14H,(H2,13,15)(H,16,17,18)(H,19,20,21);;/q;+1;-1 |
| InChIKey | JSPBUSRLKIHQCI-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|