C14H15ClO2 — CID 173142078
2-[(2-chloro-6-ethylphenyl)-hydroxymethyl]cyclopent-2-en-1-one (PubChem CID 173142078) has the molecular formula C14H15ClO2 and a molecular weight of 250.72 g/mol. Its IUPAC name is 2-[(2-chloro-6-ethylphenyl)-hydroxymethyl]cyclopent-2-en-1-one.
| Compound Name | 2-[(2-chloro-6-ethylphenyl)-hydroxymethyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 173142078 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.72 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[(2-chloro-6-ethylphenyl)-hydroxymethyl]cyclopent-2-en-1-one |
| SMILES | CCc1cccc(Cl)c1C(O)C1=CCCC1=O |
| InChI | InChI=1S/C14H15ClO2/c1-2-9-5-3-7-11(15)13(9)14(17)10-6-4-8-12(10)16/h3,5-7,14,17H,2,4,8H2,1H3 |
| InChIKey | SXTSFBIPNWMHPY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.72 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |