C24H40O8 — CID 173142572
9,12,13-triacetyloxyoctadec-3-enoic acid (PubChem CID 173142572) has the molecular formula C24H40O8 and a molecular weight of 456.58 g/mol. Its IUPAC name is 9,12,13-triacetyloxyoctadec-3-enoic acid.
| Compound Name | 9,12,13-triacetyloxyoctadec-3-enoic acid |
|---|---|
| PubChem CID | 173142572 |
| Molecular Formula | C24H40O8 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 9,12,13-triacetyloxyoctadec-3-enoic acid |
| SMILES | CCCCCC(OC(C)=O)C(CCC(CCCCC=CCC(=O)O)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C24H40O8/c1-5-6-10-14-22(31-19(3)26)23(32-20(4)27)17-16-21(30-18(2)25)13-11-8-7-9-12-15-24(28)29/h9,12,21-23H,5-8,10-11,13-17H2,1-4H3,(H,28,29) |
| InChIKey | MTRQYEUCIIWFIS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|