C21H33N5OS — CID 173147690
cis-(1R,2S)-2-amino-N-[1-(benzylcarbamothioylhydrazinylidene)-4-methylpentan-2-yl]cyclohexane-1-carboxamide (PubChem CID 173147690) has the molecular formula C21H33N5OS and a molecular weight of 403.60 g/mol. Its IUPAC name is cis-(1R,2S)-2-amino-N-[1-(benzylcarbamothioylhydrazinylidene)-4-methylpentan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-amino-N-[1-(benzylcarbamothioylhydrazinylidene)-4-methylpentan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 173147690 |
| Molecular Formula | C21H33N5OS |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | cis-(1R,2S)-2-amino-N-[1-(benzylcarbamothioylhydrazinylidene)-4-methylpentan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CC(C)CC(C=NNC(=S)NCc1ccccc1)NC(=O)[C@@H]1CCCC[C@@H]1N |
| InChI | InChI=1S/C21H33N5OS/c1-15(2)12-17(25-20(27)18-10-6-7-11-19(18)22)14-24-26-21(28)23-13-16-8-4-3-5-9-16/h3-5,8-9,14-15,17-19H,6-7,10-13,22H2,1-2H3,(H,25,27)(H2,23,26,28)/t17?,18-,19+/m1/s1 |
| InChIKey | URBMUFFZCITZQO-CPSIJMPNSA-N |
| XLogP | 2.68 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|