C27H27N — CID 173148160
3-[2-[4-(4-tert-butylphenyl)cyclohexa-2,5-dien-1-yl]phenyl]pyridine (PubChem CID 173148160) has the molecular formula C27H27N and a molecular weight of 365.52 g/mol. Its IUPAC name is 3-[2-[4-(4-tert-butylphenyl)cyclohexa-2,5-dien-1-yl]phenyl]pyridine.
| Compound Name | 3-[2-[4-(4-tert-butylphenyl)cyclohexa-2,5-dien-1-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 173148160 |
| Molecular Formula | C27H27N |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-[2-[4-(4-tert-butylphenyl)cyclohexa-2,5-dien-1-yl]phenyl]pyridine |
| SMILES | CC(C)(C)c1ccc(C2C=CC(c3ccccc3-c3cccnc3)C=C2)cc1 |
| InChI | InChI=1S/C27H27N/c1-27(2,3)24-16-14-21(15-17-24)20-10-12-22(13-11-20)25-8-4-5-9-26(25)23-7-6-18-28-19-23/h4-20,22H,1-3H3 |
| InChIKey | HBPWUVTVUWVKBL-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|