About aniline;benzenediazonium;dihydrogen phosphate
aniline;benzenediazonium;dihydrogen phosphate (PubChem CID 173150231) has the molecular formula C12H14N3O4P
and a molecular weight of 295.24 g/mol. Its IUPAC name is aniline;benzenediazonium;dihydrogen phosphate.
Molecular Properties
| Compound Name | aniline;benzenediazonium;dihydrogen phosphate |
| PubChem CID | 173150231 |
| Molecular Formula | C12H14N3O4P |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | aniline;benzenediazonium;dihydrogen phosphate |
| SMILES | N#[N+]c1ccccc1.Nc1ccccc1.O=P([O-])(O)O |
| InChI | InChI=1S/C6H5N2.C6H7N.H3O4P/c7-8-6-4-2-1-3-5-6;7-6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;1-5H,7H2;(H3,1,2,3,4)/q+1;;/p-1 |
| InChIKey | WGUJWSYIRNIWQW-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aniline;benzenediazonium;dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;benzenediazonium;dihydrogen phosphate?
The IUPAC name of aniline;benzenediazonium;dihydrogen phosphate (CID 173150231) is aniline;benzenediazonium;dihydrogen phosphate.
What is the SMILES notation for aniline;benzenediazonium;dihydrogen phosphate?
The canonical SMILES for aniline;benzenediazonium;dihydrogen phosphate is N#[N+]c1ccccc1.Nc1ccccc1.O=P([O-])(O)O.
What is the InChIKey of aniline;benzenediazonium;dihydrogen phosphate?
The InChIKey is WGUJWSYIRNIWQW-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5N2.C6H7N.H3O4P/c7-8-6-4-2-1-3-5-6;7-6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;1-5H,7H2;(H3,1,2,3,4)/q+1;;/p-1.
What are the key properties of aniline;benzenediazonium;dihydrogen phosphate?
aniline;benzenediazonium;dihydrogen phosphate has a molecular weight of 295.24 g/mol, XLogP of 1.88, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;benzenediazonium;dihydrogen phosphate is sourced from PubChem (CID 173150231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).