C10H24N2O2Si — CID 173151852
1-N'-ethyl-2-methyl-1-(oxasilinan-2-yloxy)propane-1,1-diamine (PubChem CID 173151852) has the molecular formula C10H24N2O2Si and a molecular weight of 232.40 g/mol. Its IUPAC name is 1-N'-ethyl-2-methyl-1-(oxasilinan-2-yloxy)propane-1,1-diamine.
| Compound Name | 1-N'-ethyl-2-methyl-1-(oxasilinan-2-yloxy)propane-1,1-diamine |
|---|---|
| PubChem CID | 173151852 |
| Molecular Formula | C10H24N2O2Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-N'-ethyl-2-methyl-1-(oxasilinan-2-yloxy)propane-1,1-diamine |
| SMILES | CCNC(N)(O[SiH]1CCCCO1)C(C)C |
| InChI | InChI=1S/C10H24N2O2Si/c1-4-12-10(11,9(2)3)14-15-8-6-5-7-13-15/h9,12,15H,4-8,11H2,1-3H3 |
| InChIKey | OAIJJVRQOAAWBL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|