C13H20O5Si — CID 173269824
oxasilinan-2-yl 2,3-dimethyl-4-prop-2-enoyloxybut-2-enoate (PubChem CID 173269824) has the molecular formula C13H20O5Si and a molecular weight of 284.38 g/mol. Its IUPAC name is oxasilinan-2-yl 2,3-dimethyl-4-prop-2-enoyloxybut-2-enoate.
| Compound Name | oxasilinan-2-yl 2,3-dimethyl-4-prop-2-enoyloxybut-2-enoate |
|---|---|
| PubChem CID | 173269824 |
| Molecular Formula | C13H20O5Si |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | oxasilinan-2-yl 2,3-dimethyl-4-prop-2-enoyloxybut-2-enoate |
| SMILES | C=CC(=O)OCC(C)=C(C)C(=O)O[SiH]1CCCCO1 |
| InChI | InChI=1S/C13H20O5Si/c1-4-12(14)16-9-10(2)11(3)13(15)18-19-8-6-5-7-17-19/h4,19H,1,5-9H2,2-3H3 |
| InChIKey | UBPOJXTVKWPJBJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|