C8H13NS — CID 173158965
5-(thiolan-2-yl)-2,3-dihydro-1H-pyrrole (PubChem CID 173158965) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 5-(thiolan-2-yl)-2,3-dihydro-1H-pyrrole.
| Compound Name | 5-(thiolan-2-yl)-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 173158965 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 5-(thiolan-2-yl)-2,3-dihydro-1H-pyrrole |
| SMILES | C1=C(C2CCCS2)NCC1 |
| InChI | InChI=1S/C8H13NS/c1-3-7(9-5-1)8-4-2-6-10-8/h3,8-9H,1-2,4-6H2 |
| InChIKey | ABYCFSCNKZOZPA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |