C16H28O3S2 — CID 173161421
(2R,3S,4R)-4-hydroxy-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-(3-sulfanylpropylsulfanyl)cyclopentan-1-one (PubChem CID 173161421) has the molecular formula C16H28O3S2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (2R,3S,4R)-4-hydroxy-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-(3-sulfanylpropylsulfanyl)cyclopentan-1-one.
| Compound Name | (2R,3S,4R)-4-hydroxy-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-(3-sulfanylpropylsulfanyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 173161421 |
| Molecular Formula | C16H28O3S2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (2R,3S,4R)-4-hydroxy-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-(3-sulfanylpropylsulfanyl)cyclopentan-1-one |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1SCCCS |
| InChI | InChI=1S/C16H28O3S2/c1-2-3-4-6-12(17)7-8-13-14(18)11-15(19)16(13)21-10-5-9-20/h7-8,12-14,16-18,20H,2-6,9-11H2,1H3/b8-7+/t12-,13-,14+,16+/m0/s1 |
| InChIKey | HYPZNSMZKKFKJR-ILPRWZKWSA-N |
| XLogP | 2.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|