About sodium;4-fluorobenzenethiol;hydride
sodium;4-fluorobenzenethiol;hydride (PubChem CID 173161552) has the molecular formula C6H6FNaS
and a molecular weight of 152.17 g/mol. Its IUPAC name is sodium;4-fluorobenzenethiol;hydride.
Molecular Properties
| Compound Name | sodium;4-fluorobenzenethiol;hydride |
| PubChem CID | 173161552 |
| Molecular Formula | C6H6FNaS |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.01 |
| IUPAC Name | sodium;4-fluorobenzenethiol;hydride |
| SMILES | Fc1ccc(S)cc1.[H-].[Na+] |
| InChI | InChI=1S/C6H5FS.Na.H/c7-5-1-3-6(8)4-2-5;;/h1-4,8H;;/q;+1;-1 |
| InChIKey | OBNYJUKJAROZQC-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-fluorobenzenethiol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-fluorobenzenethiol;hydride?
The IUPAC name of sodium;4-fluorobenzenethiol;hydride (CID 173161552) is sodium;4-fluorobenzenethiol;hydride.
What is the SMILES notation for sodium;4-fluorobenzenethiol;hydride?
The canonical SMILES for sodium;4-fluorobenzenethiol;hydride is Fc1ccc(S)cc1.[H-].[Na+].
What is the InChIKey of sodium;4-fluorobenzenethiol;hydride?
The InChIKey is OBNYJUKJAROZQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FS.Na.H/c7-5-1-3-6(8)4-2-5;;/h1-4,8H;;/q;+1;-1.
What are the key properties of sodium;4-fluorobenzenethiol;hydride?
sodium;4-fluorobenzenethiol;hydride has a molecular weight of 152.17 g/mol, XLogP of -0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-fluorobenzenethiol;hydride is sourced from PubChem (CID 173161552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).