C12H9F3S — CID 160881471
benzenethiol;1,2,4-trifluorobenzene (PubChem CID 160881471) has the molecular formula C12H9F3S and a molecular weight of 242.27 g/mol. Its IUPAC name is benzenethiol;1,2,4-trifluorobenzene.
| Compound Name | benzenethiol;1,2,4-trifluorobenzene |
|---|---|
| PubChem CID | 160881471 |
| Molecular Formula | C12H9F3S |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | benzenethiol;1,2,4-trifluorobenzene |
| SMILES | Fc1ccc(F)c(F)c1.Sc1ccccc1 |
| InChI | InChI=1S/C6H3F3.C6H6S/c7-4-1-2-5(8)6(9)3-4;7-6-4-2-1-3-5-6/h1-3H;1-5,7H |
| InChIKey | SNBWGLQPMAEMMA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|