C33H39N2O+ — CID 173163126
N-[4-[(1-ethylazepan-1-ium-1-yl)methyl]phenyl]-7-(4-methylphenyl)-3,4-dihydronaphthalene-1-carboxamide (PubChem CID 173163126) has the molecular formula C33H39N2O+ and a molecular weight of 479.69 g/mol. Its IUPAC name is N-[4-[(1-ethylazepan-1-ium-1-yl)methyl]phenyl]-7-(4-methylphenyl)-3,4-dihydronaphthalene-1-carboxamide.
| Compound Name | N-[4-[(1-ethylazepan-1-ium-1-yl)methyl]phenyl]-7-(4-methylphenyl)-3,4-dihydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 173163126 |
| Molecular Formula | C33H39N2O+ |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | N-[4-[(1-ethylazepan-1-ium-1-yl)methyl]phenyl]-7-(4-methylphenyl)-3,4-dihydronaphthalene-1-carboxamide |
| SMILES | CC[N+]1(Cc2ccc(NC(=O)C3=CCCc4ccc(-c5ccc(C)cc5)cc43)cc2)CCCCCC1 |
| InChI | InChI=1S/C33H38N2O/c1-3-35(21-6-4-5-7-22-35)24-26-13-19-30(20-14-26)34-33(36)31-10-8-9-28-17-18-29(23-32(28)31)27-15-11-25(2)12-16-27/h10-20,23H,3-9,21-22,24H2,1-2H3/p+1 |
| InChIKey | TYYJLBYFMPEPSP-UHFFFAOYSA-O |
| XLogP | 7.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|