C30H33N2O+ — CID 18472418
5-(4-methylphenyl)-N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-1H-indene-2-carboxamide (PubChem CID 18472418) has the molecular formula C30H33N2O+ and a molecular weight of 437.61 g/mol. Its IUPAC name is 5-(4-methylphenyl)-N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-1H-indene-2-carboxamide.
| Compound Name | 5-(4-methylphenyl)-N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 18472418 |
| Molecular Formula | C30H33N2O+ |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 5-(4-methylphenyl)-N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-1H-indene-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc3c(c2)C=C(C(=O)Nc2ccc(C[N+]4(C)CCCCC4)cc2)C3)cc1 |
| InChI | InChI=1S/C30H32N2O/c1-22-6-10-24(11-7-22)25-12-13-26-19-28(20-27(26)18-25)30(33)31-29-14-8-23(9-15-29)21-32(2)16-4-3-5-17-32/h6-15,18,20H,3-5,16-17,19,21H2,1-2H3/p+1 |
| InChIKey | DNAQGTHHMWOPDP-UHFFFAOYSA-O |
| XLogP | 6.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|