C31H35IN2O — CID 10650855
N-[4-[(1-methylazepan-1-ium-1-yl)methyl]phenyl]-7-phenyl-3,4-dihydronaphthalene-2-carboxamide iodide (PubChem CID 10650855) has the molecular formula C31H35IN2O and a molecular weight of 578.54 g/mol. Its IUPAC name is N-[4-[(1-methylazepan-1-ium-1-yl)methyl]phenyl]-7-phenyl-3,4-dihydronaphthalene-2-carboxamide iodide.
| Compound Name | N-[4-[(1-methylazepan-1-ium-1-yl)methyl]phenyl]-7-phenyl-3,4-dihydronaphthalene-2-carboxamide iodide |
|---|---|
| PubChem CID | 10650855 |
| Molecular Formula | C31H35IN2O |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | N-[4-[(1-methylazepan-1-ium-1-yl)methyl]phenyl]-7-phenyl-3,4-dihydronaphthalene-2-carboxamide iodide |
| SMILES | C[N+]1(Cc2ccc(NC(=O)C3=Cc4cc(-c5ccccc5)ccc4CC3)cc2)CCCCCC1.[I-] |
| InChI | InChI=1S/C31H34N2O.HI/c1-33(19-7-2-3-8-20-33)23-24-11-17-30(18-12-24)32-31(34)28-16-14-26-13-15-27(21-29(26)22-28)25-9-5-4-6-10-25;/h4-6,9-13,15,17-18,21-22H,2-3,7-8,14,16,19-20,23H2,1H3;1H |
| InChIKey | JYEMSYPJHDIKIB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|