C29H24Cl2N2O — CID 162221982
N-[4-[(2-chloropyridin-1-ium-1-yl)methyl]phenyl]-7-phenyl-3,4-dihydronaphthalene-2-carboxamide chloride (PubChem CID 162221982) has the molecular formula C29H24Cl2N2O and a molecular weight of 487.43 g/mol. Its IUPAC name is N-[4-[(2-chloropyridin-1-ium-1-yl)methyl]phenyl]-7-phenyl-3,4-dihydronaphthalene-2-carboxamide chloride.
| Compound Name | N-[4-[(2-chloropyridin-1-ium-1-yl)methyl]phenyl]-7-phenyl-3,4-dihydronaphthalene-2-carboxamide chloride |
|---|---|
| PubChem CID | 162221982 |
| Molecular Formula | C29H24Cl2N2O |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | N-[4-[(2-chloropyridin-1-ium-1-yl)methyl]phenyl]-7-phenyl-3,4-dihydronaphthalene-2-carboxamide chloride |
| SMILES | O=C(Nc1ccc(C[n+]2ccccc2Cl)cc1)C1=Cc2cc(-c3ccccc3)ccc2CC1.[Cl-] |
| InChI | InChI=1S/C29H23ClN2O.ClH/c30-28-8-4-5-17-32(28)20-21-9-15-27(16-10-21)31-29(33)25-14-12-23-11-13-24(18-26(23)19-25)22-6-2-1-3-7-22;/h1-11,13,15-19H,12,14,20H2;1H |
| InChIKey | ZUGBTRLDGPUCTD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|