C33H41ClN2O — CID 18472230
[4-[(7-phenyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]methyl-tripropylazanium chloride (PubChem CID 18472230) has the molecular formula C33H41ClN2O and a molecular weight of 517.16 g/mol. Its IUPAC name is [4-[(7-phenyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]methyl-tripropylazanium chloride.
| Compound Name | [4-[(7-phenyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]methyl-tripropylazanium chloride |
|---|---|
| PubChem CID | 18472230 |
| Molecular Formula | C33H41ClN2O |
| Molecular Weight | 517.16 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | [4-[(7-phenyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]methyl-tripropylazanium chloride |
| SMILES | CCC[N+](CCC)(CCC)Cc1ccc(NC(=O)C2=Cc3cc(-c4ccccc4)ccc3CC2)cc1.[Cl-] |
| InChI | InChI=1S/C33H40N2O.ClH/c1-4-20-35(21-5-2,22-6-3)25-26-12-18-32(19-13-26)34-33(36)30-17-15-28-14-16-29(23-31(28)24-30)27-10-8-7-9-11-27;/h7-14,16,18-19,23-24H,4-6,15,17,20-22,25H2,1-3H3;1H |
| InChIKey | MPFIOCBDAJJMCN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.16 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|