C32H39ClN2O — CID 69353759
[4-[(7-phenyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]-tripropylazanium chloride (PubChem CID 69353759) has the molecular formula C32H39ClN2O and a molecular weight of 503.13 g/mol. Its IUPAC name is [4-[(7-phenyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]-tripropylazanium chloride.
| Compound Name | [4-[(7-phenyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]-tripropylazanium chloride |
|---|---|
| PubChem CID | 69353759 |
| Molecular Formula | C32H39ClN2O |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | [4-[(7-phenyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]-tripropylazanium chloride |
| SMILES | CCC[N+](CCC)(CCC)c1ccc(NC(=O)C2=Cc3cc(-c4ccccc4)ccc3CC2)cc1.[Cl-] |
| InChI | InChI=1S/C32H38N2O.ClH/c1-4-20-34(21-5-2,22-6-3)31-18-16-30(17-19-31)33-32(35)28-15-13-26-12-14-27(23-29(26)24-28)25-10-8-7-9-11-25;/h7-12,14,16-19,23-24H,4-6,13,15,20-22H2,1-3H3;1H |
| InChIKey | SNJDOVIGCIFMOT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|