C29H25N2O+ — CID 18472667
7-phenyl-N-[4-(pyridin-1-ium-1-ylmethyl)phenyl]-3,4-dihydronaphthalene-2-carboxamide (PubChem CID 18472667) has the molecular formula C29H25N2O+ and a molecular weight of 417.53 g/mol. Its IUPAC name is 7-phenyl-N-[4-(pyridin-1-ium-1-ylmethyl)phenyl]-3,4-dihydronaphthalene-2-carboxamide.
| Compound Name | 7-phenyl-N-[4-(pyridin-1-ium-1-ylmethyl)phenyl]-3,4-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18472667 |
| Molecular Formula | C29H25N2O+ |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 7-phenyl-N-[4-(pyridin-1-ium-1-ylmethyl)phenyl]-3,4-dihydronaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(C[n+]2ccccc2)cc1)C1=Cc2cc(-c3ccccc3)ccc2CC1 |
| InChI | InChI=1S/C29H24N2O/c32-29(30-28-15-9-22(10-16-28)21-31-17-5-2-6-18-31)26-14-12-24-11-13-25(19-27(24)20-26)23-7-3-1-4-8-23/h1-11,13,15-20H,12,14,21H2/p+1 |
| InChIKey | XBLTUFRJWMOBKV-UHFFFAOYSA-O |
| XLogP | 5.66 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|