C13H23NO6Si — CID 173164828
(2S)-5-diethylsilyloxy-2-(2-methylprop-2-enoyloxyamino)-5-oxopentanoic acid (PubChem CID 173164828) has the molecular formula C13H23NO6Si and a molecular weight of 317.41 g/mol. Its IUPAC name is (2S)-5-diethylsilyloxy-2-(2-methylprop-2-enoyloxyamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-diethylsilyloxy-2-(2-methylprop-2-enoyloxyamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 173164828 |
| Molecular Formula | C13H23NO6Si |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (2S)-5-diethylsilyloxy-2-(2-methylprop-2-enoyloxyamino)-5-oxopentanoic acid |
| SMILES | C=C(C)C(=O)ON[C@@H](CCC(=O)O[SiH](CC)CC)C(=O)O |
| InChI | InChI=1S/C13H23NO6Si/c1-5-21(6-2)20-11(15)8-7-10(12(16)17)14-19-13(18)9(3)4/h10,14,21H,3,5-8H2,1-2,4H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | IBTAMDAZAINQLJ-JTQLQIEISA-N |
| XLogP | 1.15 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|