C13H13N4O2+ — CID 173165638
2-methyl-5-phenylmethoxy-1H-imidazo[4,5-d]pyridazin-3-ium-4-one (PubChem CID 173165638) has the molecular formula C13H13N4O2+ and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-methyl-5-phenylmethoxy-1H-imidazo[4,5-d]pyridazin-3-ium-4-one.
| Compound Name | 2-methyl-5-phenylmethoxy-1H-imidazo[4,5-d]pyridazin-3-ium-4-one |
|---|---|
| PubChem CID | 173165638 |
| Molecular Formula | C13H13N4O2+ |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-methyl-5-phenylmethoxy-1H-imidazo[4,5-d]pyridazin-3-ium-4-one |
| SMILES | Cc1[nH]c2cnn(OCc3ccccc3)c(=O)c2[nH+]1 |
| InChI | InChI=1S/C13H12N4O2/c1-9-15-11-7-14-17(13(18)12(11)16-9)19-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,15,16)/p+1 |
| InChIKey | MZRJHBBLPNEDIE-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |