C15H10FN7O — CID 173167805
3-(4-fluorophenyl)-N-(2H-tetrazol-5-yl)indazole-1-carboxamide (PubChem CID 173167805) has the molecular formula C15H10FN7O and a molecular weight of 323.29 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(2H-tetrazol-5-yl)indazole-1-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-(2H-tetrazol-5-yl)indazole-1-carboxamide |
|---|---|
| PubChem CID | 173167805 |
| Molecular Formula | C15H10FN7O |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(2H-tetrazol-5-yl)indazole-1-carboxamide |
| SMILES | O=C(Nc1nn[nH]n1)n1nc(-c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C15H10FN7O/c16-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)23(20-13)15(24)17-14-18-21-22-19-14/h1-8H,(H2,17,18,19,21,22,24) |
| InChIKey | RKCKXMZQVBVYOR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |