C21H27NO2 — CID 173168921
N,N-dimethyl-2-[3-(3-phenylmethoxyphenyl)cyclobutyl]oxyethanamine (PubChem CID 173168921) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-(3-phenylmethoxyphenyl)cyclobutyl]oxyethanamine.
| Compound Name | N,N-dimethyl-2-[3-(3-phenylmethoxyphenyl)cyclobutyl]oxyethanamine |
|---|---|
| PubChem CID | 173168921 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N,N-dimethyl-2-[3-(3-phenylmethoxyphenyl)cyclobutyl]oxyethanamine |
| SMILES | CN(C)CCOC1CC(c2cccc(OCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C21H27NO2/c1-22(2)11-12-23-21-14-19(15-21)18-9-6-10-20(13-18)24-16-17-7-4-3-5-8-17/h3-10,13,19,21H,11-12,14-16H2,1-2H3 |
| InChIKey | LDCZSXODHGKCKA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |