C25H28BrNO2 — CID 163370258
N-[(2E)-3-bromo-1-[4-(3-phenylmethoxyphenyl)cyclohexyl]oxypenta-2,4-dien-2-yl]methanimine (PubChem CID 163370258) has the molecular formula C25H28BrNO2 and a molecular weight of 454.41 g/mol. Its IUPAC name is N-[(2E)-3-bromo-1-[4-(3-phenylmethoxyphenyl)cyclohexyl]oxypenta-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2E)-3-bromo-1-[4-(3-phenylmethoxyphenyl)cyclohexyl]oxypenta-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 163370258 |
| Molecular Formula | C25H28BrNO2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-[(2E)-3-bromo-1-[4-(3-phenylmethoxyphenyl)cyclohexyl]oxypenta-2,4-dien-2-yl]methanimine |
| SMILES | C=C/C(Br)=C(/COC1CCC(c2cccc(OCc3ccccc3)c2)CC1)N=C |
| InChI | InChI=1S/C25H28BrNO2/c1-3-24(26)25(27-2)18-29-22-14-12-20(13-15-22)21-10-7-11-23(16-21)28-17-19-8-5-4-6-9-19/h3-11,16,20,22H,1-2,12-15,17-18H2/b25-24+ |
| InChIKey | YHKKLKHXVRQDSN-OCOZRVBESA-N |
| XLogP | 6.80 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|