C21H26O3 — CID 18955609
1-(3,3-dimethoxycyclohexyl)-3-phenylmethoxybenzene (PubChem CID 18955609) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-(3,3-dimethoxycyclohexyl)-3-phenylmethoxybenzene.
| Compound Name | 1-(3,3-dimethoxycyclohexyl)-3-phenylmethoxybenzene |
|---|---|
| PubChem CID | 18955609 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-(3,3-dimethoxycyclohexyl)-3-phenylmethoxybenzene |
| SMILES | COC1(OC)CCCC(c2cccc(OCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C21H26O3/c1-22-21(23-2)13-7-11-19(15-21)18-10-6-12-20(14-18)24-16-17-8-4-3-5-9-17/h3-6,8-10,12,14,19H,7,11,13,15-16H2,1-2H3 |
| InChIKey | YQYSGHAIKDOFSX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|