C22H28NO2+ — CID 7773518
(1R,4aS,8aS)-1-(3-phenylmethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 7773518) has the molecular formula C22H28NO2+ and a molecular weight of 338.47 g/mol. Its IUPAC name is (1R,4aS,8aS)-1-(3-phenylmethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1R,4aS,8aS)-1-(3-phenylmethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 7773518 |
| Molecular Formula | C22H28NO2+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1R,4aS,8aS)-1-(3-phenylmethoxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | O[C@]12CCCC[C@H]1[C@H](c1cccc(OCc3ccccc3)c1)[NH2+]CC2 |
| InChI | InChI=1S/C22H27NO2/c24-22-12-5-4-11-20(22)21(23-14-13-22)18-9-6-10-19(15-18)25-16-17-7-2-1-3-8-17/h1-3,6-10,15,20-21,23-24H,4-5,11-14,16H2/p+1/t20-,21-,22-/m0/s1 |
| InChIKey | NXWLYGWIEVOKFF-FKBYEOEOSA-O |
| XLogP | 3.20 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |