C17H26NO3+ — CID 7087749
(1R,4aS,8aS)-1-(3-ethoxy-4-hydroxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 7087749) has the molecular formula C17H26NO3+ and a molecular weight of 292.40 g/mol. Its IUPAC name is (1R,4aS,8aS)-1-(3-ethoxy-4-hydroxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1R,4aS,8aS)-1-(3-ethoxy-4-hydroxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 7087749 |
| Molecular Formula | C17H26NO3+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (1R,4aS,8aS)-1-(3-ethoxy-4-hydroxyphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | CCOc1cc([C@@H]2[NH2+]CC[C@@]3(O)CCCC[C@@H]23)ccc1O |
| InChI | InChI=1S/C17H25NO3/c1-2-21-15-11-12(6-7-14(15)19)16-13-5-3-4-8-17(13,20)9-10-18-16/h6-7,11,13,16,18-20H,2-5,8-10H2,1H3/p+1/t13-,16-,17-/m0/s1 |
| InChIKey | FJRAFGQYLIQWHC-JQFCIGGWSA-O |
| XLogP | 1.72 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |