C16H24NO+ — CID 788707
(1S,4aS,8aS)-1-(4-methylphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 788707) has the molecular formula C16H24NO+ and a molecular weight of 246.37 g/mol. Its IUPAC name is (1S,4aS,8aS)-1-(4-methylphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | (1S,4aS,8aS)-1-(4-methylphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 788707 |
| Molecular Formula | C16H24NO+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (1S,4aS,8aS)-1-(4-methylphenyl)-2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | Cc1ccc([C@H]2[NH2+]CC[C@@]3(O)CCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C16H23NO/c1-12-5-7-13(8-6-12)15-14-4-2-3-9-16(14,18)10-11-17-15/h5-8,14-15,17-18H,2-4,9-11H2,1H3/p+1/t14-,15+,16-/m0/s1 |
| InChIKey | YQDZCQUVNRHELP-XHSDSOJGSA-O |
| XLogP | 1.92 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |