C20H32N2O6 — CID 173171362
14,19-dioxa-1,8-diazabicyclo[19.3.0]tetracosane-2,7,13,20-tetrone (PubChem CID 173171362) has the molecular formula C20H32N2O6 and a molecular weight of 396.48 g/mol. Its IUPAC name is 14,19-dioxa-1,8-diazabicyclo[19.3.0]tetracosane-2,7,13,20-tetrone.
| Compound Name | 14,19-dioxa-1,8-diazabicyclo[19.3.0]tetracosane-2,7,13,20-tetrone |
|---|---|
| PubChem CID | 173171362 |
| Molecular Formula | C20H32N2O6 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 14,19-dioxa-1,8-diazabicyclo[19.3.0]tetracosane-2,7,13,20-tetrone |
| SMILES | O=C1CCCCC(=O)N2CCCC2C(=O)OCCCCOC(=O)CCCCN1 |
| InChI | InChI=1S/C20H32N2O6/c23-17-9-1-2-10-18(24)22-13-7-8-16(22)20(26)28-15-6-5-14-27-19(25)11-3-4-12-21-17/h16H,1-15H2,(H,21,23) |
| InChIKey | YPCNWXIYVIXZTK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |