C16H16Zr — CID 173176184
cyclopenta-1,3-diene;1,3-dimethylinden-1-ide;zirconium(2+) (PubChem CID 173176184) has the molecular formula C16H16Zr and a molecular weight of 299.53 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1,3-dimethylinden-1-ide;zirconium(2+).
| Compound Name | cyclopenta-1,3-diene;1,3-dimethylinden-1-ide;zirconium(2+) |
|---|---|
| PubChem CID | 173176184 |
| Molecular Formula | C16H16Zr |
| Molecular Weight | 299.53 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | cyclopenta-1,3-diene;1,3-dimethylinden-1-ide;zirconium(2+) |
| SMILES | Cc1c[c-](C)c2ccccc12.[C-]1=CC=CC1.[Zr+2] |
| InChI | InChI=1S/C11H11.C5H5.Zr/c1-8-7-9(2)11-6-4-3-5-10(8)11;1-2-4-5-3-1;/h3-7H,1-2H3;1-3H,4H2;/q2*-1;+2 |
| InChIKey | YVPNPENVWJKHPD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|