C16H15F3N4OS — CID 173176261
5-[2-(2-methoxyethylamino)-6-(trifluoromethyl)-3-pyridinyl]-1,3-benzothiazol-2-amine (PubChem CID 173176261) has the molecular formula C16H15F3N4OS and a molecular weight of 368.38 g/mol. Its IUPAC name is 5-[2-(2-methoxyethylamino)-6-(trifluoromethyl)-3-pyridinyl]-1,3-benzothiazol-2-amine.
| Compound Name | 5-[2-(2-methoxyethylamino)-6-(trifluoromethyl)-3-pyridinyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 173176261 |
| Molecular Formula | C16H15F3N4OS |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 5-[2-(2-methoxyethylamino)-6-(trifluoromethyl)-3-pyridinyl]-1,3-benzothiazol-2-amine |
| SMILES | COCCNc1nc(C(F)(F)F)ccc1-c1ccc2sc(N)nc2c1 |
| InChI | InChI=1S/C16H15F3N4OS/c1-24-7-6-21-14-10(3-5-13(23-14)16(17,18)19)9-2-4-12-11(8-9)22-15(20)25-12/h2-5,8H,6-7H2,1H3,(H2,20,22)(H,21,23) |
| InChIKey | UWVGARREAAYYBH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|