About 2-cyclononyl-1H-pyrrole
2-cyclononyl-1H-pyrrole (PubChem CID 173176738) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-cyclononyl-1H-pyrrole.
Molecular Properties
| Compound Name | 2-cyclononyl-1H-pyrrole |
| PubChem CID | 173176738 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2-cyclononyl-1H-pyrrole |
| SMILES | c1c[nH]c(C2CCCCCCCC2)c1 |
| InChI | InChI=1S/C13H21N/c1-2-4-6-9-12(8-5-3-1)13-10-7-11-14-13/h7,10-12,14H,1-6,8-9H2 |
| InChIKey | ZKCANUIKLWPJQD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-cyclononyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclononyl-1H-pyrrole?
The IUPAC name of 2-cyclononyl-1H-pyrrole (CID 173176738) is 2-cyclononyl-1H-pyrrole.
What is the SMILES notation for 2-cyclononyl-1H-pyrrole?
The canonical SMILES for 2-cyclononyl-1H-pyrrole is c1c[nH]c(C2CCCCCCCC2)c1.
What is the InChIKey of 2-cyclononyl-1H-pyrrole?
The InChIKey is ZKCANUIKLWPJQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-2-4-6-9-12(8-5-3-1)13-10-7-11-14-13/h7,10-12,14H,1-6,8-9H2.
What are the key properties of 2-cyclononyl-1H-pyrrole?
2-cyclononyl-1H-pyrrole has a molecular weight of 191.32 g/mol, XLogP of 4.23, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclononyl-1H-pyrrole is sourced from PubChem (CID 173176738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).