About 2-cycloheptyl-1H-pyrrole;hydrochloride
2-cycloheptyl-1H-pyrrole;hydrochloride (PubChem CID 175314820) has the molecular formula C11H18ClN
and a molecular weight of 199.72 g/mol. Its IUPAC name is 2-cycloheptyl-1H-pyrrole;hydrochloride.
Molecular Properties
| Compound Name | 2-cycloheptyl-1H-pyrrole;hydrochloride |
| PubChem CID | 175314820 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-cycloheptyl-1H-pyrrole;hydrochloride |
| SMILES | Cl.c1c[nH]c(C2CCCCCC2)c1 |
| InChI | InChI=1S/C11H17N.ClH/c1-2-4-7-10(6-3-1)11-8-5-9-12-11;/h5,8-10,12H,1-4,6-7H2;1H |
| InChIKey | AROMCHGDSGYFQS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.72 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-cycloheptyl-1H-pyrrole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-1H-pyrrole;hydrochloride?
The IUPAC name of 2-cycloheptyl-1H-pyrrole;hydrochloride (CID 175314820) is 2-cycloheptyl-1H-pyrrole;hydrochloride.
What is the SMILES notation for 2-cycloheptyl-1H-pyrrole;hydrochloride?
The canonical SMILES for 2-cycloheptyl-1H-pyrrole;hydrochloride is Cl.c1c[nH]c(C2CCCCCC2)c1.
What is the InChIKey of 2-cycloheptyl-1H-pyrrole;hydrochloride?
The InChIKey is AROMCHGDSGYFQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.ClH/c1-2-4-7-10(6-3-1)11-8-5-9-12-11;/h5,8-10,12H,1-4,6-7H2;1H.
What are the key properties of 2-cycloheptyl-1H-pyrrole;hydrochloride?
2-cycloheptyl-1H-pyrrole;hydrochloride has a molecular weight of 199.72 g/mol, XLogP of 3.87, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-1H-pyrrole;hydrochloride is sourced from PubChem (CID 175314820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).