About 2-(oxan-2-yl)-1H-pyrrole
2-(oxan-2-yl)-1H-pyrrole (PubChem CID 70382280) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-(oxan-2-yl)-1H-pyrrole.
Molecular Properties
| Compound Name | 2-(oxan-2-yl)-1H-pyrrole |
| PubChem CID | 70382280 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-(oxan-2-yl)-1H-pyrrole |
| SMILES | c1c[nH]c(C2CCCCO2)c1 |
| InChI | InChI=1S/C9H13NO/c1-2-7-11-9(5-1)8-4-3-6-10-8/h3-4,6,9-10H,1-2,5,7H2 |
| InChIKey | IGOOZOBBOKTGKY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(oxan-2-yl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-2-yl)-1H-pyrrole?
The IUPAC name of 2-(oxan-2-yl)-1H-pyrrole (CID 70382280) is 2-(oxan-2-yl)-1H-pyrrole.
What is the SMILES notation for 2-(oxan-2-yl)-1H-pyrrole?
The canonical SMILES for 2-(oxan-2-yl)-1H-pyrrole is c1c[nH]c(C2CCCCO2)c1.
What is the InChIKey of 2-(oxan-2-yl)-1H-pyrrole?
The InChIKey is IGOOZOBBOKTGKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-2-7-11-9(5-1)8-4-3-6-10-8/h3-4,6,9-10H,1-2,5,7H2.
What are the key properties of 2-(oxan-2-yl)-1H-pyrrole?
2-(oxan-2-yl)-1H-pyrrole has a molecular weight of 151.21 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-2-yl)-1H-pyrrole is sourced from PubChem (CID 70382280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).