C14H25NS — CID 173177311
2,3-dipentyl-4H-1,4-thiazine (PubChem CID 173177311) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 2,3-dipentyl-4H-1,4-thiazine.
| Compound Name | 2,3-dipentyl-4H-1,4-thiazine |
|---|---|
| PubChem CID | 173177311 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2,3-dipentyl-4H-1,4-thiazine |
| SMILES | CCCCCC1=C(CCCCC)SC=CN1 |
| InChI | InChI=1S/C14H25NS/c1-3-5-7-9-13-14(10-8-6-4-2)16-12-11-15-13/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | QUPDZBVHXUVRET-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|