C12H21NS — CID 173177242
2,3-dibutyl-4H-1,4-thiazine (PubChem CID 173177242) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 2,3-dibutyl-4H-1,4-thiazine.
| Compound Name | 2,3-dibutyl-4H-1,4-thiazine |
|---|---|
| PubChem CID | 173177242 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2,3-dibutyl-4H-1,4-thiazine |
| SMILES | CCCCC1=C(CCCC)SC=CN1 |
| InChI | InChI=1S/C12H21NS/c1-3-5-7-11-12(8-6-4-2)14-10-9-13-11/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | XETLTXXYPYXYGQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |