About 3-methyl-2-nonyl-4H-1,4-thiazine
3-methyl-2-nonyl-4H-1,4-thiazine (PubChem CID 173177284) has the molecular formula C14H25NS
and a molecular weight of 239.43 g/mol. Its IUPAC name is 3-methyl-2-nonyl-4H-1,4-thiazine.
Molecular Properties
| Compound Name | 3-methyl-2-nonyl-4H-1,4-thiazine |
| PubChem CID | 173177284 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-methyl-2-nonyl-4H-1,4-thiazine |
| SMILES | CCCCCCCCCC1=C(C)NC=CS1 |
| InChI | InChI=1S/C14H25NS/c1-3-4-5-6-7-8-9-10-14-13(2)15-11-12-16-14/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | INCCMARXAPQLJB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-nonyl-4H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-nonyl-4H-1,4-thiazine?
The IUPAC name of 3-methyl-2-nonyl-4H-1,4-thiazine (CID 173177284) is 3-methyl-2-nonyl-4H-1,4-thiazine.
What is the SMILES notation for 3-methyl-2-nonyl-4H-1,4-thiazine?
The canonical SMILES for 3-methyl-2-nonyl-4H-1,4-thiazine is CCCCCCCCCC1=C(C)NC=CS1.
What is the InChIKey of 3-methyl-2-nonyl-4H-1,4-thiazine?
The InChIKey is INCCMARXAPQLJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NS/c1-3-4-5-6-7-8-9-10-14-13(2)15-11-12-16-14/h11-12,15H,3-10H2,1-2H3.
What are the key properties of 3-methyl-2-nonyl-4H-1,4-thiazine?
3-methyl-2-nonyl-4H-1,4-thiazine has a molecular weight of 239.43 g/mol, XLogP of 5.17, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-nonyl-4H-1,4-thiazine is sourced from PubChem (CID 173177284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).