About 2-heptyl-3,4-dimethylthiophene
2-heptyl-3,4-dimethylthiophene (PubChem CID 142681632) has the molecular formula C13H22S
and a molecular weight of 210.39 g/mol. Its IUPAC name is 2-heptyl-3,4-dimethylthiophene.
Molecular Properties
| Compound Name | 2-heptyl-3,4-dimethylthiophene |
| PubChem CID | 142681632 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-heptyl-3,4-dimethylthiophene |
| SMILES | CCCCCCCc1scc(C)c1C |
| InChI | InChI=1S/C13H22S/c1-4-5-6-7-8-9-13-12(3)11(2)10-14-13/h10H,4-9H2,1-3H3 |
| InChIKey | IMKVQAGSBYGLCI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-3,4-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-3,4-dimethylthiophene?
The IUPAC name of 2-heptyl-3,4-dimethylthiophene (CID 142681632) is 2-heptyl-3,4-dimethylthiophene.
What is the SMILES notation for 2-heptyl-3,4-dimethylthiophene?
The canonical SMILES for 2-heptyl-3,4-dimethylthiophene is CCCCCCCc1scc(C)c1C.
What is the InChIKey of 2-heptyl-3,4-dimethylthiophene?
The InChIKey is IMKVQAGSBYGLCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22S/c1-4-5-6-7-8-9-13-12(3)11(2)10-14-13/h10H,4-9H2,1-3H3.
What are the key properties of 2-heptyl-3,4-dimethylthiophene?
2-heptyl-3,4-dimethylthiophene has a molecular weight of 210.39 g/mol, XLogP of 4.88, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-3,4-dimethylthiophene is sourced from PubChem (CID 142681632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).