About 5,6-dibutyl-1,2-benzothiazol-3-one
5,6-dibutyl-1,2-benzothiazol-3-one (PubChem CID 165391065) has the molecular formula C15H21NOS
and a molecular weight of 263.41 g/mol. Its IUPAC name is 5,6-dibutyl-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 5,6-dibutyl-1,2-benzothiazol-3-one |
| PubChem CID | 165391065 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5,6-dibutyl-1,2-benzothiazol-3-one |
| SMILES | CCCCc1cc2s[nH]c(=O)c2cc1CCCC |
| InChI | InChI=1S/C15H21NOS/c1-3-5-7-11-9-13-14(18-16-15(13)17)10-12(11)8-6-4-2/h9-10H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | VZTWURRKVLAYMY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dibutyl-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dibutyl-1,2-benzothiazol-3-one?
The IUPAC name of 5,6-dibutyl-1,2-benzothiazol-3-one (CID 165391065) is 5,6-dibutyl-1,2-benzothiazol-3-one.
What is the SMILES notation for 5,6-dibutyl-1,2-benzothiazol-3-one?
The canonical SMILES for 5,6-dibutyl-1,2-benzothiazol-3-one is CCCCc1cc2s[nH]c(=O)c2cc1CCCC.
What is the InChIKey of 5,6-dibutyl-1,2-benzothiazol-3-one?
The InChIKey is VZTWURRKVLAYMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NOS/c1-3-5-7-11-9-13-14(18-16-15(13)17)10-12(11)8-6-4-2/h9-10H,3-8H2,1-2H3,(H,16,17).
What are the key properties of 5,6-dibutyl-1,2-benzothiazol-3-one?
5,6-dibutyl-1,2-benzothiazol-3-one has a molecular weight of 263.41 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dibutyl-1,2-benzothiazol-3-one is sourced from PubChem (CID 165391065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).