C36H40I2O2 — CID 10055900
2,3,8,9-tetrabutyl-5,11-diiodoindeno[1,2-b]fluorene-6,12-dione (PubChem CID 10055900) has the molecular formula C36H40I2O2 and a molecular weight of 758.52 g/mol. Its IUPAC name is 2,3,8,9-tetrabutyl-5,11-diiodoindeno[1,2-b]fluorene-6,12-dione.
| Compound Name | 2,3,8,9-tetrabutyl-5,11-diiodoindeno[1,2-b]fluorene-6,12-dione |
|---|---|
| PubChem CID | 10055900 |
| Molecular Formula | C36H40I2O2 |
| Molecular Weight | 758.52 g/mol |
| Exact Mass | 758.11 |
| IUPAC Name | 2,3,8,9-tetrabutyl-5,11-diiodoindeno[1,2-b]fluorene-6,12-dione |
| SMILES | CCCCc1cc2c(=O)c3c(I)c4c(c(I)c3c2cc1CCCC)c(=O)c1cc(CCCC)c(CCCC)cc14 |
| InChI | InChI=1S/C36H40I2O2/c1-5-9-13-21-17-25-27(19-23(21)15-11-7-3)35(39)31-29(25)33(37)32-30(34(31)38)26-18-22(14-10-6-2)24(16-12-8-4)20-28(26)36(32)40/h17-20H,5-16H2,1-4H3 |
| InChIKey | KRHNJSGZSSBPCV-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.52 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|