C20H25N5O4 — CID 173179540
(7aS)-2-[4-[methyl-(2-pyrrolidin-1-ylacetyl)amino]phenyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide (PubChem CID 173179540) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (7aS)-2-[4-[methyl-(2-pyrrolidin-1-ylacetyl)amino]phenyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide.
| Compound Name | (7aS)-2-[4-[methyl-(2-pyrrolidin-1-ylacetyl)amino]phenyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
|---|---|
| PubChem CID | 173179540 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (7aS)-2-[4-[methyl-(2-pyrrolidin-1-ylacetyl)amino]phenyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
| SMILES | CN(C(=O)CN1CCCC1)c1ccc(N2C(=O)N3CCC[C@]3(C(N)=O)C2=O)cc1 |
| InChI | InChI=1S/C20H25N5O4/c1-22(16(26)13-23-10-2-3-11-23)14-5-7-15(8-6-14)25-18(28)20(17(21)27)9-4-12-24(20)19(25)29/h5-8H,2-4,9-13H2,1H3,(H2,21,27)/t20-/m0/s1 |
| InChIKey | WVUFLZINJXUMMC-FQEVSTJZSA-N |
| XLogP | 0.53 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|