C18H24N6O4S — CID 173179640
(7aR)-2-[4-[2-(methanesulfonamido)-5,6-dihydro-4H-pyrimidin-1-yl]phenyl]-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-7a-carboxamide (PubChem CID 173179640) has the molecular formula C18H24N6O4S and a molecular weight of 420.50 g/mol. Its IUPAC name is (7aR)-2-[4-[2-(methanesulfonamido)-5,6-dihydro-4H-pyrimidin-1-yl]phenyl]-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-7a-carboxamide.
| Compound Name | (7aR)-2-[4-[2-(methanesulfonamido)-5,6-dihydro-4H-pyrimidin-1-yl]phenyl]-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-7a-carboxamide |
|---|---|
| PubChem CID | 173179640 |
| Molecular Formula | C18H24N6O4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (7aR)-2-[4-[2-(methanesulfonamido)-5,6-dihydro-4H-pyrimidin-1-yl]phenyl]-3-oxo-1,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-7a-carboxamide |
| SMILES | CS(=O)(=O)NC1=NCCCN1c1ccc(N2C[C@@]3(C(N)=O)CCCN3C2=O)cc1 |
| InChI | InChI=1S/C18H24N6O4S/c1-29(27,28)21-16-20-9-3-10-22(16)13-4-6-14(7-5-13)23-12-18(15(19)25)8-2-11-24(18)17(23)26/h4-7H,2-3,8-12H2,1H3,(H2,19,25)(H,20,21)/t18-/m1/s1 |
| InChIKey | CUHNKCMTOJKXBL-GOSISDBHSA-N |
| XLogP | 0.06 |
| TPSA | 128.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |