C22H19N3O — CID 173179855
N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine (PubChem CID 173179855) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 173179855 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine |
| SMILES | C1=CC(Nc2cc(-c3ccc(Oc4ccccc4)cc3)ncn2)=CCC1 |
| InChI | InChI=1S/C22H19N3O/c1-3-7-18(8-4-1)25-22-15-21(23-16-24-22)17-11-13-20(14-12-17)26-19-9-5-2-6-10-19/h2-3,5-16H,1,4H2,(H,23,24,25) |
| InChIKey | SVMCMTXKTBJPHJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |