About N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine
N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine (PubChem CID 173179855) has the molecular formula C22H19N3O
and a molecular weight of 341.41 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine |
| PubChem CID | 173179855 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine |
| SMILES | C1=CC(Nc2cc(-c3ccc(Oc4ccccc4)cc3)ncn2)=CCC1 |
| InChI | InChI=1S/C22H19N3O/c1-3-7-18(8-4-1)25-22-15-21(23-16-24-22)17-11-13-20(14-12-17)26-19-9-5-2-6-10-19/h2-3,5-16H,1,4H2,(H,23,24,25) |
| InChIKey | SVMCMTXKTBJPHJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine (CID 173179855) is N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine is C1=CC(Nc2cc(-c3ccc(Oc4ccccc4)cc3)ncn2)=CCC1.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine?
The InChIKey is SVMCMTXKTBJPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O/c1-3-7-18(8-4-1)25-22-15-21(23-16-24-22)17-11-13-20(14-12-17)26-19-9-5-2-6-10-19/h2-3,5-16H,1,4H2,(H,23,24,25).
What are the key properties of N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine?
N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine has a molecular weight of 341.41 g/mol, XLogP of 5.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-6-(4-phenoxyphenyl)pyrimidin-4-amine is sourced from PubChem (CID 173179855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).