About di(propan-2-yl)-propan-2-ylidene-λ5-arsane
di(propan-2-yl)-propan-2-ylidene-λ5-arsane (PubChem CID 173183911) has the molecular formula C9H21As
and a molecular weight of 204.19 g/mol. Its IUPAC name is di(propan-2-yl)-propan-2-ylidene-λ5-arsane.
Molecular Properties
| Compound Name | di(propan-2-yl)-propan-2-ylidene-λ5-arsane |
| PubChem CID | 173183911 |
| Molecular Formula | C9H21As |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | di(propan-2-yl)-propan-2-ylidene-λ5-arsane |
| SMILES | CC(C)=[AsH](C(C)C)C(C)C |
| InChI | InChI=1S/C9H21As/c1-7(2)10(8(3)4)9(5)6/h7-8,10H,1-6H3 |
| InChIKey | FCQBALUMWHERQZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(propan-2-yl)-propan-2-ylidene-λ5-arsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yl)-propan-2-ylidene-λ5-arsane?
The IUPAC name of di(propan-2-yl)-propan-2-ylidene-λ5-arsane (CID 173183911) is di(propan-2-yl)-propan-2-ylidene-λ5-arsane.
What is the SMILES notation for di(propan-2-yl)-propan-2-ylidene-λ5-arsane?
The canonical SMILES for di(propan-2-yl)-propan-2-ylidene-λ5-arsane is CC(C)=[AsH](C(C)C)C(C)C.
What is the InChIKey of di(propan-2-yl)-propan-2-ylidene-λ5-arsane?
The InChIKey is FCQBALUMWHERQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21As/c1-7(2)10(8(3)4)9(5)6/h7-8,10H,1-6H3.
What are the key properties of di(propan-2-yl)-propan-2-ylidene-λ5-arsane?
di(propan-2-yl)-propan-2-ylidene-λ5-arsane has a molecular weight of 204.19 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)-propan-2-ylidene-λ5-arsane is sourced from PubChem (CID 173183911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).